C15H29N7O5 — CID 144515278
2-[(5S,11S)-11-[3-(diaminomethylideneamino)propyl]-4,7,10-trioxo-1,3,6,9-tetrazacycloundec-5-yl]acetic acid;ethane (PubChem CID 144515278) has the molecular formula C15H29N7O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[(5S,11S)-11-[3-(diaminomethylideneamino)propyl]-4,7,10-trioxo-1,3,6,9-tetrazacycloundec-5-yl]acetic acid;ethane.
| Compound Name | 2-[(5S,11S)-11-[3-(diaminomethylideneamino)propyl]-4,7,10-trioxo-1,3,6,9-tetrazacycloundec-5-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 144515278 |
| Molecular Formula | C15H29N7O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[(5S,11S)-11-[3-(diaminomethylideneamino)propyl]-4,7,10-trioxo-1,3,6,9-tetrazacycloundec-5-yl]acetic acid;ethane |
| SMILES | CC.NC(N)=NCCC[C@@H]1NCNC(=O)[C@H](CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C13H23N7O5.C2H6/c14-13(15)16-3-1-2-7-11(24)17-5-9(21)20-8(4-10(22)23)12(25)19-6-18-7;1-2/h7-8,18H,1-6H2,(H,17,24)(H,19,25)(H,20,21)(H,22,23)(H4,14,15,16);1-2H3/t7-,8-;/m0./s1 |
| InChIKey | DZYMWFHUWQQOCD-WSZWBAFRSA-N |
| XLogP | -2.81 |
| TPSA | 201.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|