C21H31N11O9 — CID 25136799
2-[(5S,8R,14R)-5-(carboxymethyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid (PubChem CID 25136799) has the molecular formula C21H31N11O9 and a molecular weight of 581.55 g/mol. Its IUPAC name is 2-[(5S,8R,14R)-5-(carboxymethyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid.
| Compound Name | 2-[(5S,8R,14R)-5-(carboxymethyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
|---|---|
| PubChem CID | 25136799 |
| Molecular Formula | C21H31N11O9 |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 2-[(5S,8R,14R)-5-(carboxymethyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@H]1NC(=O)[C@H](CC(=O)O)NC(=O)Cn2cc(nn2)CNC(=O)[C@@H](CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C21H31N11O9/c22-21(23)24-3-1-2-11-18(39)26-7-14(33)27-12(4-16(35)36)19(40)25-6-10-8-32(31-30-10)9-15(34)28-13(5-17(37)38)20(41)29-11/h8,11-13H,1-7,9H2,(H,25,40)(H,26,39)(H,27,33)(H,28,34)(H,29,41)(H,35,36)(H,37,38)(H4,22,23,24)/t11-,12-,13+/m1/s1 |
| InChIKey | CFZCVZSDZBJYST-UPJWGTAASA-N |
| XLogP | -5.52 |
| TPSA | 315.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|