C18H32N8O6 — CID 11178569
2-[(2S,5S,8S)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]acetic acid (PubChem CID 11178569) has the molecular formula C18H32N8O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[(2S,5S,8S)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]acetic acid.
| Compound Name | 2-[(2S,5S,8S)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]acetic acid |
|---|---|
| PubChem CID | 11178569 |
| Molecular Formula | C18H32N8O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[(2S,5S,8S)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]acetic acid |
| SMILES | NCCCC[C@@H]1NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C18H32N8O6/c19-6-2-1-4-11-16(31)25-10(5-3-7-22-18(20)21)15(30)23-9-13(27)24-12(8-14(28)29)17(32)26-11/h10-12H,1-9,19H2,(H,23,30)(H,24,27)(H,25,31)(H,26,32)(H,28,29)(H4,20,21,22)/t10-,11-,12-/m0/s1 |
| InChIKey | QHZVWHYSPLIAOE-SRVKXCTJSA-N |
| XLogP | -3.77 |
| TPSA | 244.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|