C15H25N7O6 — CID 24786639
2-[(2S,9R)-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid (PubChem CID 24786639) has the molecular formula C15H25N7O6 and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[(2S,9R)-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid.
| Compound Name | 2-[(2S,9R)-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid |
|---|---|
| PubChem CID | 24786639 |
| Molecular Formula | C15H25N7O6 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[(2S,9R)-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@H]1NC(=O)CC(=O)N[C@@H](CC(=O)O)C(=O)NCCNC1=O |
| InChI | InChI=1S/C15H25N7O6/c16-15(17)20-3-1-2-8-13(27)18-4-5-19-14(28)9(6-12(25)26)22-11(24)7-10(23)21-8/h8-9H,1-7H2,(H,18,27)(H,19,28)(H,21,23)(H,22,24)(H,25,26)(H4,16,17,20)/t8-,9+/m1/s1 |
| InChIKey | PYGLHCWPRJWZFA-BDAKNGLRSA-N |
| XLogP | -3.88 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|