C25H29N7O6S2 — CID 10438335
2-[(12S,18S)-18-[3-(diaminomethylideneamino)propyl]-11,14,17,20-tetraoxo-2,3-dithia-10,13,16,19-tetrazatricyclo[19.4.0.04,9]pentacosa-1(25),4,6,8,21,23-hexaen-12-yl]acetic acid (PubChem CID 10438335) has the molecular formula C25H29N7O6S2 and a molecular weight of 587.68 g/mol. Its IUPAC name is 2-[(12S,18S)-18-[3-(diaminomethylideneamino)propyl]-11,14,17,20-tetraoxo-2,3-dithia-10,13,16,19-tetrazatricyclo[19.4.0.04,9]pentacosa-1(25),4,6,8,21,23-hexaen-12-yl]acetic acid.
| Compound Name | 2-[(12S,18S)-18-[3-(diaminomethylideneamino)propyl]-11,14,17,20-tetraoxo-2,3-dithia-10,13,16,19-tetrazatricyclo[19.4.0.04,9]pentacosa-1(25),4,6,8,21,23-hexaen-12-yl]acetic acid |
|---|---|
| PubChem CID | 10438335 |
| Molecular Formula | C25H29N7O6S2 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 2-[(12S,18S)-18-[3-(diaminomethylideneamino)propyl]-11,14,17,20-tetraoxo-2,3-dithia-10,13,16,19-tetrazatricyclo[19.4.0.04,9]pentacosa-1(25),4,6,8,21,23-hexaen-12-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)c2ccccc2SSc2ccccc2NC(=O)[C@H](CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C25H29N7O6S2/c26-25(27)28-11-5-8-16-23(37)29-13-20(33)30-17(12-21(34)35)24(38)31-15-7-2-4-10-19(15)40-39-18-9-3-1-6-14(18)22(36)32-16/h1-4,6-7,9-10,16-17H,5,8,11-13H2,(H,29,37)(H,30,33)(H,31,38)(H,32,36)(H,34,35)(H4,26,27,28)/t16-,17-/m0/s1 |
| InChIKey | HJMWYGPOMVSGID-IRXDYDNUSA-N |
| XLogP | 0.67 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|