C25H36N10O7S — CID 71765789
2-[(2S,8S,17R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-11-phenyl-17-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetamide (PubChem CID 71765789) has the molecular formula C25H36N10O7S and a molecular weight of 620.69 g/mol. Its IUPAC name is 2-[(2S,8S,17R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-11-phenyl-17-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetamide.
| Compound Name | 2-[(2S,8S,17R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-11-phenyl-17-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetamide |
|---|---|
| PubChem CID | 71765789 |
| Molecular Formula | C25H36N10O7S |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 2-[(2S,8S,17R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15,18-hexaoxo-11-phenyl-17-(sulfanylmethyl)-1,4,7,10,13,16-hexazacyclooctadec-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1NC(=O)[C@H](CS)NC(=O)CNC(=O)C(c2ccccc2)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC1=O |
| InChI | InChI=1S/C25H36N10O7S/c26-17(36)9-15-21(39)30-10-18(37)32-14(7-4-8-29-25(27)28)22(40)35-20(13-5-2-1-3-6-13)24(42)31-11-19(38)33-16(12-43)23(41)34-15/h1-3,5-6,14-16,20,43H,4,7-12H2,(H2,26,36)(H,30,39)(H,31,42)(H,32,37)(H,33,38)(H,34,41)(H,35,40)(H4,27,28,29)/t14-,15-,16-,20?/m0/s1 |
| InChIKey | QPWYSBAPPJRFPH-TVISWJTBSA-N |
| XLogP | -4.60 |
| TPSA | 282.09 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|