C27H37N8O11S — CID 59873378
CID 59873378 (PubChem CID 59873378) has the molecular formula C27H37N8O11S and a molecular weight of 681.71 g/mol.
| Compound Name | CID 59873378 |
|---|---|
| PubChem CID | 59873378 |
| Molecular Formula | C27H37N8O11S |
| Molecular Weight | 681.71 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | — |
| SMILES | NC(N)=NCCCC1NC(=O)C(c2ccccc2)SCC(C(O)O)NC(=O)C([CH]C(=O)O)NC(=O)C(CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C27H37N8O11S/c28-27(29)30-8-4-7-14-22(41)31-11-18(36)32-15(9-19(37)38)23(42)34-16(10-20(39)40)24(43)35-17(26(45)46)12-47-21(25(44)33-14)13-5-2-1-3-6-13/h1-3,5-6,10,14-17,21,26,45-46H,4,7-9,11-12H2,(H,31,41)(H,32,36)(H,33,44)(H,34,42)(H,35,43)(H,37,38)(H,39,40)(H4,28,29,30) |
| InChIKey | ZEPMQHALZSLLHM-UHFFFAOYSA-N |
| XLogP | -4.34 |
| TPSA | 324.96 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.71 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|