C24H36N8O5 — CID 102015235
2-[3-[(2S,8R,11S)-8-benzyl-3,6,9,12,15-pentaoxo-11-propan-2-yl-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine (PubChem CID 102015235) has the molecular formula C24H36N8O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[3-[(2S,8R,11S)-8-benzyl-3,6,9,12,15-pentaoxo-11-propan-2-yl-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,8R,11S)-8-benzyl-3,6,9,12,15-pentaoxo-11-propan-2-yl-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 102015235 |
| Molecular Formula | C24H36N8O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[3-[(2S,8R,11S)-8-benzyl-3,6,9,12,15-pentaoxo-11-propan-2-yl-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC1=O |
| InChI | InChI=1S/C24H36N8O5/c1-14(2)20-23(37)29-13-18(33)30-16(9-6-10-27-24(25)26)21(35)28-12-19(34)31-17(22(36)32-20)11-15-7-4-3-5-8-15/h3-5,7-8,14,16-17,20H,6,9-13H2,1-2H3,(H,28,35)(H,29,37)(H,30,33)(H,31,34)(H,32,36)(H4,25,26,27)/t16-,17+,20-/m0/s1 |
| InChIKey | QNSQOCIHRZDNSS-QKLQHJQFSA-N |
| XLogP | -2.36 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|