C28H39N9O8 — CID 134826470
2-[(3S,6S,12S,18S)-3-benzyl-12-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]acetic acid (PubChem CID 134826470) has the molecular formula C28H39N9O8 and a molecular weight of 629.68 g/mol. Its IUPAC name is 2-[(3S,6S,12S,18S)-3-benzyl-12-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]acetic acid.
| Compound Name | 2-[(3S,6S,12S,18S)-3-benzyl-12-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]acetic acid |
|---|---|
| PubChem CID | 134826470 |
| Molecular Formula | C28H39N9O8 |
| Molecular Weight | 629.68 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | 2-[(3S,6S,12S,18S)-3-benzyl-12-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)CNC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C28H39N9O8/c29-28(30)31-10-4-8-17-24(42)32-14-22(39)35-18(13-23(40)41)25(43)36-19(12-16-6-2-1-3-7-16)27(45)37-11-5-9-20(37)26(44)33-15-21(38)34-17/h1-3,6-7,17-20H,4-5,8-15H2,(H,32,42)(H,33,44)(H,34,38)(H,35,39)(H,36,43)(H,40,41)(H4,29,30,31)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | GUOSIKCQILJPGN-MUGJNUQGSA-N |
| XLogP | -3.55 |
| TPSA | 267.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.68 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|