C22H31N7O6 — CID 44628053
2-[(2R,5S,9S)-5-benzyl-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid (PubChem CID 44628053) has the molecular formula C22H31N7O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-[(2R,5S,9S)-5-benzyl-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid.
| Compound Name | 2-[(2R,5S,9S)-5-benzyl-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid |
|---|---|
| PubChem CID | 44628053 |
| Molecular Formula | C22H31N7O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[(2R,5S,9S)-5-benzyl-9-[3-(diaminomethylideneamino)propyl]-3,8,11,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]acetic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)CC(=O)N[C@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)CNC1=O |
| InChI | InChI=1S/C22H31N7O6/c23-22(24)25-8-4-7-15-20(34)26-12-14(9-13-5-2-1-3-6-13)27-21(35)16(10-19(32)33)29-18(31)11-17(30)28-15/h1-3,5-6,14-16H,4,7-12H2,(H,26,34)(H,27,35)(H,28,30)(H,29,31)(H,32,33)(H4,23,24,25)/t14-,15-,16+/m0/s1 |
| InChIKey | JBCUWZUACLSOTF-HRCADAONSA-N |
| XLogP | -2.27 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|