C18H31N9O6S2 — CID 10392324
2-[(2S,8S,11R,14R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-11,14-bis(sulfanylmethyl)-1,4,7,10,13-pentazacyclopentadec-2-yl]acetamide (PubChem CID 10392324) has the molecular formula C18H31N9O6S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is 2-[(2S,8S,11R,14R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-11,14-bis(sulfanylmethyl)-1,4,7,10,13-pentazacyclopentadec-2-yl]acetamide.
| Compound Name | 2-[(2S,8S,11R,14R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-11,14-bis(sulfanylmethyl)-1,4,7,10,13-pentazacyclopentadec-2-yl]acetamide |
|---|---|
| PubChem CID | 10392324 |
| Molecular Formula | C18H31N9O6S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-[(2S,8S,11R,14R)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-11,14-bis(sulfanylmethyl)-1,4,7,10,13-pentazacyclopentadec-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC1=O |
| InChI | InChI=1S/C18H31N9O6S2/c19-12(28)4-9-14(30)23-5-13(29)24-8(2-1-3-22-18(20)21)15(31)26-11(7-35)17(33)27-10(6-34)16(32)25-9/h8-11,34-35H,1-7H2,(H2,19,28)(H,23,30)(H,24,29)(H,25,32)(H,26,31)(H,27,33)(H4,20,21,22)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | FVFDCXIUNRXQDD-NAKRPEOUSA-N |
| XLogP | -5.16 |
| TPSA | 252.99 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|