C11H19N5O3 — CID 10038719
2-[3-[3,6-dioxo-5-(2-oxopropyl)piperazin-2-yl]propyl]guanidine (PubChem CID 10038719) has the molecular formula C11H19N5O3 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[3-[3,6-dioxo-5-(2-oxopropyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[3,6-dioxo-5-(2-oxopropyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 10038719 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[3-[3,6-dioxo-5-(2-oxopropyl)piperazin-2-yl]propyl]guanidine |
| SMILES | CC(=O)CC1NC(=O)C(CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C11H19N5O3/c1-6(17)5-8-10(19)15-7(9(18)16-8)3-2-4-14-11(12)13/h7-8H,2-5H2,1H3,(H,15,19)(H,16,18)(H4,12,13,14) |
| InChIKey | XRHXBHJQCPXMEJ-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|