C20H29N7O5 — CID 102412277
2-[3-[(2S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-8-methyl-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine (PubChem CID 102412277) has the molecular formula C20H29N7O5 and a molecular weight of 447.50 g/mol. Its IUPAC name is 2-[3-[(2S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-8-methyl-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-8-methyl-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 102412277 |
| Molecular Formula | C20H29N7O5 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[3-[(2S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-8-methyl-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propyl]guanidine |
| SMILES | C[C@@H]1NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C20H29N7O5/c1-11-17(30)27-15(9-12-4-6-13(28)7-5-12)19(32)26-14(3-2-8-23-20(21)22)18(31)24-10-16(29)25-11/h4-7,11,14-15,28H,2-3,8-10H2,1H3,(H,24,31)(H,25,29)(H,26,32)(H,27,30)(H4,21,22,23)/t11-,14-,15-/m0/s1 |
| InChIKey | SJBQNNIGOPJEGV-CQDKDKBSSA-N |
| XLogP | -2.41 |
| TPSA | 201.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|