C22H32N8O6 — CID 10874810
3-[(2R,5S,8R)-8-[3-(diaminomethylideneamino)propyl]-5-[(4-hydroxyphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propanamide (PubChem CID 10874810) has the molecular formula C22H32N8O6 and a molecular weight of 504.55 g/mol. Its IUPAC name is 3-[(2R,5S,8R)-8-[3-(diaminomethylideneamino)propyl]-5-[(4-hydroxyphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propanamide.
| Compound Name | 3-[(2R,5S,8R)-8-[3-(diaminomethylideneamino)propyl]-5-[(4-hydroxyphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propanamide |
|---|---|
| PubChem CID | 10874810 |
| Molecular Formula | C22H32N8O6 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 3-[(2R,5S,8R)-8-[3-(diaminomethylideneamino)propyl]-5-[(4-hydroxyphenyl)methyl]-3,6,9,12-tetraoxo-1,4,7,10-tetrazacyclododec-2-yl]propanamide |
| SMILES | NC(=O)CC[C@H]1NC(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C22H32N8O6/c23-17(32)8-7-15-20(35)30-16(10-12-3-5-13(31)6-4-12)21(36)29-14(2-1-9-26-22(24)25)19(34)27-11-18(33)28-15/h3-6,14-16,31H,1-2,7-11H2,(H2,23,32)(H,27,34)(H,28,33)(H,29,36)(H,30,35)(H4,24,25,26)/t14-,15-,16+/m1/s1 |
| InChIKey | GJSNWYCXGVOCMN-OAGGEKHMSA-N |
| XLogP | -3.16 |
| TPSA | 244.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|