C37H43N9O6 — CID 140752504
2-[3-[(5R,11R)-14-benzyl-11-[(4-hydroxyphenyl)methyl]-5-(1H-indol-3-ylmethyl)-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine (PubChem CID 140752504) has the molecular formula C37H43N9O6 and a molecular weight of 709.81 g/mol. Its IUPAC name is 2-[3-[(5R,11R)-14-benzyl-11-[(4-hydroxyphenyl)methyl]-5-(1H-indol-3-ylmethyl)-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(5R,11R)-14-benzyl-11-[(4-hydroxyphenyl)methyl]-5-(1H-indol-3-ylmethyl)-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 140752504 |
| Molecular Formula | C37H43N9O6 |
| Molecular Weight | 709.81 g/mol |
| Exact Mass | 709.33 |
| IUPAC Name | 2-[3-[(5R,11R)-14-benzyl-11-[(4-hydroxyphenyl)methyl]-5-(1H-indol-3-ylmethyl)-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCC1NC(=O)C(Cc2ccccc2)NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)CNC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C37H43N9O6/c38-37(39)40-16-6-11-28-34(50)46-31(19-24-20-41-27-10-5-4-9-26(24)27)33(49)42-21-32(48)43-29(18-23-12-14-25(47)15-13-23)35(51)45-30(36(52)44-28)17-22-7-2-1-3-8-22/h1-5,7-10,12-15,20,28-31,41,47H,6,11,16-19,21H2,(H,42,49)(H,43,48)(H,44,52)(H,45,51)(H,46,50)(H4,38,39,40)/t28?,29-,30?,31-/m1/s1 |
| InChIKey | MFIQGOQLQIPLCK-VWKIIYCGSA-N |
| XLogP | 0.02 |
| TPSA | 245.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.81 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|