C15H24N6O4 — CID 159980430
acetylene;2-[(2S)-2-[3-(diaminomethylideneamino)propyl]-3,7,9-trioxo-1,4-diazonan-6-yl]acetamide (PubChem CID 159980430) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is acetylene;2-[(2S)-2-[3-(diaminomethylideneamino)propyl]-3,7,9-trioxo-1,4-diazonan-6-yl]acetamide.
| Compound Name | acetylene;2-[(2S)-2-[3-(diaminomethylideneamino)propyl]-3,7,9-trioxo-1,4-diazonan-6-yl]acetamide |
|---|---|
| PubChem CID | 159980430 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | acetylene;2-[(2S)-2-[3-(diaminomethylideneamino)propyl]-3,7,9-trioxo-1,4-diazonan-6-yl]acetamide |
| SMILES | C#C.NC(=O)CC1CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CC1=O |
| InChI | InChI=1S/C13H22N6O4.C2H2/c14-10(21)4-7-6-18-12(23)8(2-1-3-17-13(15)16)19-11(22)5-9(7)20;1-2/h7-8H,1-6H2,(H2,14,21)(H,18,23)(H,19,22)(H4,15,16,17);1-2H/t7?,8-;/m0./s1 |
| InChIKey | OFRRAXNEVNXCLT-MTICXXPYSA-N |
| XLogP | -2.65 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|