C27H47N7O6 — CID 10929817
2-[(2S,8S,12R,14S,15E,17S,19R)-8-[3-(diaminomethylideneamino)propyl]-12,14,17,19-tetramethyl-3,6,9,21-tetraoxo-1,4,7,10-tetrazacyclohenicos-15-en-2-yl]acetic acid (PubChem CID 10929817) has the molecular formula C27H47N7O6 and a molecular weight of 565.72 g/mol. Its IUPAC name is 2-[(2S,8S,12R,14S,15E,17S,19R)-8-[3-(diaminomethylideneamino)propyl]-12,14,17,19-tetramethyl-3,6,9,21-tetraoxo-1,4,7,10-tetrazacyclohenicos-15-en-2-yl]acetic acid.
| Compound Name | 2-[(2S,8S,12R,14S,15E,17S,19R)-8-[3-(diaminomethylideneamino)propyl]-12,14,17,19-tetramethyl-3,6,9,21-tetraoxo-1,4,7,10-tetrazacyclohenicos-15-en-2-yl]acetic acid |
|---|---|
| PubChem CID | 10929817 |
| Molecular Formula | C27H47N7O6 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.36 |
| IUPAC Name | 2-[(2S,8S,12R,14S,15E,17S,19R)-8-[3-(diaminomethylideneamino)propyl]-12,14,17,19-tetramethyl-3,6,9,21-tetraoxo-1,4,7,10-tetrazacyclohenicos-15-en-2-yl]acetic acid |
| SMILES | C[C@H]1CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)C[C@H](C)C[C@H](C)/C=C/[C@@H](C)C1 |
| InChI | InChI=1S/C27H47N7O6/c1-16-7-8-17(2)11-19(4)14-31-25(39)20(6-5-9-30-27(28)29)33-23(36)15-32-26(40)21(13-24(37)38)34-22(35)12-18(3)10-16/h7-8,16-21H,5-6,9-15H2,1-4H3,(H,31,39)(H,32,40)(H,33,36)(H,34,35)(H,37,38)(H4,28,29,30)/b8-7+/t16-,17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | PISVQNUCONTDES-NQVAJGTQSA-N |
| XLogP | 0.00 |
| TPSA | 218.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|