C19H31N11O6 — CID 44552442
2-[(1S,4S,10S,13S)-14-(2-azidoethyl)-10-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-2,5,8,11,14-pentazabicyclo[11.2.1]hexadecan-4-yl]acetic acid (PubChem CID 44552442) has the molecular formula C19H31N11O6 and a molecular weight of 509.53 g/mol. Its IUPAC name is 2-[(1S,4S,10S,13S)-14-(2-azidoethyl)-10-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-2,5,8,11,14-pentazabicyclo[11.2.1]hexadecan-4-yl]acetic acid.
| Compound Name | 2-[(1S,4S,10S,13S)-14-(2-azidoethyl)-10-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-2,5,8,11,14-pentazabicyclo[11.2.1]hexadecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 44552442 |
| Molecular Formula | C19H31N11O6 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 2-[(1S,4S,10S,13S)-14-(2-azidoethyl)-10-[3-(diaminomethylideneamino)propyl]-3,6,9,12-tetraoxo-2,5,8,11,14-pentazabicyclo[11.2.1]hexadecan-4-yl]acetic acid |
| SMILES | [N-]=[N+]=NCCN1C[C@@H]2C[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N2 |
| InChI | InChI=1S/C19H31N11O6/c20-19(21)23-3-1-2-11-16(34)24-8-14(31)27-12(7-15(32)33)17(35)26-10-6-13(18(36)28-11)30(9-10)5-4-25-29-22/h10-13H,1-9H2,(H,24,34)(H,26,35)(H,27,31)(H,28,36)(H,32,33)(H4,20,21,23)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | IYTCYVYMVHEUIX-CYDGBPFRSA-N |
| XLogP | -3.52 |
| TPSA | 270.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|