C25H41N9O7S — CID 10841441
2-[(1R,4S,7S,13S,16S,19S)-7-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14-pentaoxo-4-propan-2-yl-20-thia-3,6,9,12,15,22-hexazatricyclo[14.5.2.019,22]tricosan-13-yl]acetic acid (PubChem CID 10841441) has the molecular formula C25H41N9O7S and a molecular weight of 611.73 g/mol. Its IUPAC name is 2-[(1R,4S,7S,13S,16S,19S)-7-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14-pentaoxo-4-propan-2-yl-20-thia-3,6,9,12,15,22-hexazatricyclo[14.5.2.019,22]tricosan-13-yl]acetic acid.
| Compound Name | 2-[(1R,4S,7S,13S,16S,19S)-7-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14-pentaoxo-4-propan-2-yl-20-thia-3,6,9,12,15,22-hexazatricyclo[14.5.2.019,22]tricosan-13-yl]acetic acid |
|---|---|
| PubChem CID | 10841441 |
| Molecular Formula | C25H41N9O7S |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 2-[(1R,4S,7S,13S,16S,19S)-7-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14-pentaoxo-4-propan-2-yl-20-thia-3,6,9,12,15,22-hexazatricyclo[14.5.2.019,22]tricosan-13-yl]acetic acid |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H]2CS[C@H]3CC[C@@H](CN32)NC(=O)[C@H](CC(=O)O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C25H41N9O7S/c1-12(2)20-24(41)32-14(4-3-7-28-25(26)27)21(38)29-9-17(35)31-15(8-19(36)37)22(39)30-13-5-6-18-34(10-13)16(11-42-18)23(40)33-20/h12-16,18,20H,3-11H2,1-2H3,(H,29,38)(H,30,39)(H,31,35)(H,32,41)(H,33,40)(H,36,37)(H4,26,27,28)/t13-,14-,15-,16-,18-,20-/m0/s1 |
| InChIKey | GMMADXSVGBBMDC-MMEQEAHYSA-N |
| XLogP | -3.22 |
| TPSA | 250.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|