C23H38N12O7 — CID 25136801
2-[(5S,8R,14R)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid (PubChem CID 25136801) has the molecular formula C23H38N12O7 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2-[(5S,8R,14R)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid.
| Compound Name | 2-[(5S,8R,14R)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
|---|---|
| PubChem CID | 25136801 |
| Molecular Formula | C23H38N12O7 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 2-[(5S,8R,14R)-5-(4-aminobutyl)-8-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13,16,19,20-octazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
| SMILES | NCCCC[C@@H]1NC(=O)Cn2cc(nn2)CNC(=O)[C@@H](CC(=O)O)NC(=O)CNC(=O)[C@@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C23H38N12O7/c24-6-2-1-4-15-22(42)32-14(5-3-7-27-23(25)26)20(40)29-10-17(36)31-16(8-19(38)39)21(41)28-9-13-11-35(34-33-13)12-18(37)30-15/h11,14-16H,1-10,12,24H2,(H,28,41)(H,29,40)(H,30,37)(H,31,36)(H,32,42)(H,38,39)(H4,25,26,27)/t14-,15+,16-/m1/s1 |
| InChIKey | FOUINCWEPLMKBI-OWCLPIDISA-N |
| XLogP | -4.86 |
| TPSA | 303.93 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|