C26H37N8O10S — CID 59873382
CID 59873382 (PubChem CID 59873382) has the molecular formula C26H37N8O10S and a molecular weight of 653.70 g/mol.
| Compound Name | CID 59873382 |
|---|---|
| PubChem CID | 59873382 |
| Molecular Formula | C26H37N8O10S |
| Molecular Weight | 653.70 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | — |
| SMILES | NC(N)=NCCCC1NC(=O)C(Cc2ccc(O)cc2)NC(=O)CSCC(C(O)O)NC(=O)C([CH]C(=O)O)NC(=O)CNC1=O |
| InChI | InChI=1S/C26H37N8O10S/c27-26(28)29-7-1-2-15-22(40)30-10-19(36)31-17(9-21(38)39)24(42)34-18(25(43)44)11-45-12-20(37)32-16(23(41)33-15)8-13-3-5-14(35)6-4-13/h3-6,9,15-18,25,35,43-44H,1-2,7-8,10-12H2,(H,30,40)(H,31,36)(H,32,37)(H,33,41)(H,34,42)(H,38,39)(H4,27,28,29) |
| InChIKey | ZWUZYQMSXVTXQN-UHFFFAOYSA-N |
| XLogP | -4.61 |
| TPSA | 307.89 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.70 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|