C11H25N5O3 — CID 143552690
ethane;formic acid;2-[3-(3-oxopiperazin-2-yl)propyl]guanidine (PubChem CID 143552690) has the molecular formula C11H25N5O3 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethane;formic acid;2-[3-(3-oxopiperazin-2-yl)propyl]guanidine.
| Compound Name | ethane;formic acid;2-[3-(3-oxopiperazin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 143552690 |
| Molecular Formula | C11H25N5O3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | ethane;formic acid;2-[3-(3-oxopiperazin-2-yl)propyl]guanidine |
| SMILES | CC.NC(N)=NCCCC1NCCNC1=O.O=CO |
| InChI | InChI=1S/C8H17N5O.C2H6.CH2O2/c9-8(10)13-3-1-2-6-7(14)12-5-4-11-6;1-2;2-1-3/h6,11H,1-5H2,(H,12,14)(H4,9,10,13);1-2H3;1H,(H,2,3) |
| InChIKey | BBORBSVRCZSJPW-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|