C33H54N8O5 — CID 10580011
2-[3-[(3S,6S,9S,12S)-12-benzyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-3-yl]propyl]guanidine (PubChem CID 10580011) has the molecular formula C33H54N8O5 and a molecular weight of 642.85 g/mol. Its IUPAC name is 2-[3-[(3S,6S,9S,12S)-12-benzyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3S,6S,9S,12S)-12-benzyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 10580011 |
| Molecular Formula | C33H54N8O5 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.42 |
| IUPAC Name | 2-[3-[(3S,6S,9S,12S)-12-benzyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-3-yl]propyl]guanidine |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)CCCCCNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C33H54N8O5/c1-21(2)18-25-30(44)39-24(14-11-17-37-33(34)35)29(43)36-16-10-6-9-15-28(42)38-27(20-23-12-7-5-8-13-23)32(46)41-26(19-22(3)4)31(45)40-25/h5,7-8,12-13,21-22,24-27H,6,9-11,14-20H2,1-4H3,(H,36,43)(H,38,42)(H,39,44)(H,40,45)(H,41,46)(H4,34,35,37)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | KWZYSVDRQQFWAH-FWEHEUNISA-N |
| XLogP | 1.00 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|