C38H59N9O6 — CID 71562655
2-[3-[(3S,6S,9S,15S,29S)-15-benzyl-6-methyl-2,5,8,14,17,28-hexaoxo-1,4,7,13,16,27-hexazatricyclo[27.3.0.09,13]dotriacontan-3-yl]propyl]guanidine (PubChem CID 71562655) has the molecular formula C38H59N9O6 and a molecular weight of 737.95 g/mol. Its IUPAC name is 2-[3-[(3S,6S,9S,15S,29S)-15-benzyl-6-methyl-2,5,8,14,17,28-hexaoxo-1,4,7,13,16,27-hexazatricyclo[27.3.0.09,13]dotriacontan-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3S,6S,9S,15S,29S)-15-benzyl-6-methyl-2,5,8,14,17,28-hexaoxo-1,4,7,13,16,27-hexazatricyclo[27.3.0.09,13]dotriacontan-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 71562655 |
| Molecular Formula | C38H59N9O6 |
| Molecular Weight | 737.95 g/mol |
| Exact Mass | 737.46 |
| IUPAC Name | 2-[3-[(3S,6S,9S,15S,29S)-15-benzyl-6-methyl-2,5,8,14,17,28-hexaoxo-1,4,7,13,16,27-hexazatricyclo[27.3.0.09,13]dotriacontan-3-yl]propyl]guanidine |
| SMILES | C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)CCCCCCCCCNC(=O)[C@@H]2CCCN2C(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C38H59N9O6/c1-26-33(49)45-28(17-12-22-42-38(39)40)36(52)46-23-13-18-30(46)34(50)41-21-11-6-4-2-3-5-10-20-32(48)44-29(25-27-15-8-7-9-16-27)37(53)47-24-14-19-31(47)35(51)43-26/h7-9,15-16,26,28-31H,2-6,10-14,17-25H2,1H3,(H,41,50)(H,43,51)(H,44,48)(H,45,49)(H4,39,40,42)/t26-,28-,29-,30-,31-/m0/s1 |
| InChIKey | GZFHDQJCXSMNJI-PZBSVLGOSA-N |
| XLogP | 0.99 |
| TPSA | 221.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.95 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|