About 2-(3,6-dioxopiperazin-2-yl)acetic acid
2-(3,6-dioxopiperazin-2-yl)acetic acid (PubChem CID 67867045) has the molecular formula C6H8N2O4
and a molecular weight of 172.14 g/mol. Its IUPAC name is 2-(3,6-dioxopiperazin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,6-dioxopiperazin-2-yl)acetic acid |
| PubChem CID | 67867045 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-(3,6-dioxopiperazin-2-yl)acetic acid |
| SMILES | O=C(O)CC1NC(=O)CNC1=O |
| InChI | InChI=1S/C6H8N2O4/c9-4-2-7-6(12)3(8-4)1-5(10)11/h3H,1-2H2,(H,7,12)(H,8,9)(H,10,11) |
| InChIKey | STTIAONCINEOLF-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,6-dioxopiperazin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dioxopiperazin-2-yl)acetic acid?
The IUPAC name of 2-(3,6-dioxopiperazin-2-yl)acetic acid (CID 67867045) is 2-(3,6-dioxopiperazin-2-yl)acetic acid.
What is the SMILES notation for 2-(3,6-dioxopiperazin-2-yl)acetic acid?
The canonical SMILES for 2-(3,6-dioxopiperazin-2-yl)acetic acid is O=C(O)CC1NC(=O)CNC1=O.
What is the InChIKey of 2-(3,6-dioxopiperazin-2-yl)acetic acid?
The InChIKey is STTIAONCINEOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c9-4-2-7-6(12)3(8-4)1-5(10)11/h3H,1-2H2,(H,7,12)(H,8,9)(H,10,11).
What are the key properties of 2-(3,6-dioxopiperazin-2-yl)acetic acid?
2-(3,6-dioxopiperazin-2-yl)acetic acid has a molecular weight of 172.14 g/mol, XLogP of -1.92, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dioxopiperazin-2-yl)acetic acid is sourced from PubChem (CID 67867045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).