C26H35N9O8 — CID 71526883
(1R,5S,12S,16S)-19-benzyl-5-[3-(diaminomethylideneamino)propyl]-4,7,10,14,18,20-hexaoxo-3,6,9,13,17,19-hexazabicyclo[14.2.2]icosane-12-carboxylic acid (PubChem CID 71526883) has the molecular formula C26H35N9O8 and a molecular weight of 601.62 g/mol. Its IUPAC name is (1R,5S,12S,16S)-19-benzyl-5-[3-(diaminomethylideneamino)propyl]-4,7,10,14,18,20-hexaoxo-3,6,9,13,17,19-hexazabicyclo[14.2.2]icosane-12-carboxylic acid.
| Compound Name | (1R,5S,12S,16S)-19-benzyl-5-[3-(diaminomethylideneamino)propyl]-4,7,10,14,18,20-hexaoxo-3,6,9,13,17,19-hexazabicyclo[14.2.2]icosane-12-carboxylic acid |
|---|---|
| PubChem CID | 71526883 |
| Molecular Formula | C26H35N9O8 |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (1R,5S,12S,16S)-19-benzyl-5-[3-(diaminomethylideneamino)propyl]-4,7,10,14,18,20-hexaoxo-3,6,9,13,17,19-hexazabicyclo[14.2.2]icosane-12-carboxylic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)CNC(=O)C[C@@H](C(=O)O)NC(=O)C[C@@H]2NC(=O)[C@@H](CNC1=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C26H35N9O8/c27-26(28)29-8-4-7-15-22(39)31-11-18-23(40)34-16(24(41)35(18)13-14-5-2-1-3-6-14)9-20(37)33-17(25(42)43)10-19(36)30-12-21(38)32-15/h1-3,5-6,15-18H,4,7-13H2,(H,30,36)(H,31,39)(H,32,38)(H,33,37)(H,34,40)(H,42,43)(H4,27,28,29)/t15-,16-,17-,18+/m0/s1 |
| InChIKey | ISISVCNEPAHVAF-XLAORIBOSA-N |
| XLogP | -3.98 |
| TPSA | 267.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|