C10H10N2O2 — CID 53360215
(5S)-5-(phenyl(113C)methyl)imidazolidine-2,4-dione (PubChem CID 53360215) has the molecular formula C10H10N2O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is (5S)-5-(phenyl(113C)methyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(phenyl(113C)methyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 53360215 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (5S)-5-(phenyl(113C)methyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H]([13CH2]c2ccccc2)N1 |
| InChI | InChI=1S/C10H10N2O2/c13-9-8(11-10(14)12-9)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,11,12,13,14)/t8-/m0/s1/i6+1 |
| InChIKey | DBOMTIHROGSFTI-JCNVXSMLSA-N |
| XLogP | 0.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|