C13H13N2O4- — CID 6950802
2-[(2R,5S)-5-benzyl-3,6-dioxopiperazin-2-yl]acetate (PubChem CID 6950802) has the molecular formula C13H13N2O4- and a molecular weight of 261.26 g/mol. Its IUPAC name is 2-[(2R,5S)-5-benzyl-3,6-dioxopiperazin-2-yl]acetate.
| Compound Name | 2-[(2R,5S)-5-benzyl-3,6-dioxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 6950802 |
| Molecular Formula | C13H13N2O4- |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[(2R,5S)-5-benzyl-3,6-dioxopiperazin-2-yl]acetate |
| SMILES | O=C([O-])C[C@H]1NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C13H14N2O4/c16-11(17)7-10-13(19)14-9(12(18)15-10)6-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,14,19)(H,15,18)(H,16,17)/p-1/t9-,10+/m0/s1 |
| InChIKey | VNHJXYUDIBQDDX-VHSXEESVSA-M |
| XLogP | -1.65 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |