C56H58N6O6 — CID 10855003
(3S,6S,9R,12S,15S,18R)-3,6,9,12,15,18-hexabenzyl-1,10-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 10855003) has the molecular formula C56H58N6O6 and a molecular weight of 911.12 g/mol. Its IUPAC name is (3S,6S,9R,12S,15S,18R)-3,6,9,12,15,18-hexabenzyl-1,10-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6S,9R,12S,15S,18R)-3,6,9,12,15,18-hexabenzyl-1,10-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 10855003 |
| Molecular Formula | C56H58N6O6 |
| Molecular Weight | 911.12 g/mol |
| Exact Mass | 910.44 |
| IUPAC Name | (3S,6S,9R,12S,15S,18R)-3,6,9,12,15,18-hexabenzyl-1,10-dimethyl-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CN1C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C56H58N6O6/c1-61-49(37-43-29-17-7-18-30-43)53(65)57-45(33-39-21-9-3-10-22-39)52(64)60-48(36-42-27-15-6-16-28-42)56(68)62(2)50(38-44-31-19-8-20-32-44)54(66)58-46(34-40-23-11-4-12-24-40)51(63)59-47(55(61)67)35-41-25-13-5-14-26-41/h3-32,45-50H,33-38H2,1-2H3,(H,57,65)(H,58,66)(H,59,63)(H,60,64)/t45-,46-,47-,48-,49+,50+/m0/s1 |
| InChIKey | HTLNPHMLXYSUHB-NDKHYYEUSA-N |
| XLogP | 5.05 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.12 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |