C23H22N4O2 — CID 132546652
(3S,6S)-3,6-bis(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione (PubChem CID 132546652) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (3S,6S)-3,6-bis(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 132546652 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (3S,6S)-3,6-bis(1H-indol-3-ylmethyl)-1-methylpiperazine-2,5-dione |
| SMILES | CN1C(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H22N4O2/c1-27-21(11-15-13-25-19-9-5-3-7-17(15)19)22(28)26-20(23(27)29)10-14-12-24-18-8-4-2-6-16(14)18/h2-9,12-13,20-21,24-25H,10-11H2,1H3,(H,26,28)/t20-,21-/m0/s1 |
| InChIKey | CAOAVYQTKHOZQL-SFTDATJTSA-N |
| XLogP | 2.76 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |