C15H17N3OS — CID 143030497
cyclopropane;5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 143030497) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is cyclopropane;5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | cyclopropane;5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 143030497 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | cyclopropane;5-(1H-indol-3-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | C1CC1.O=C1NC(=S)NC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H11N3OS.C3H6/c16-11-10(14-12(17)15-11)5-7-6-13-9-4-2-1-3-8(7)9;1-2-3-1/h1-4,6,10,13H,5H2,(H2,14,15,16,17);1-3H2 |
| InChIKey | HSSRGUVMFCTIFH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|