C35H37N5O4 — CID 147053500
(3S,6S,9S,12R,14S)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-14-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 147053500) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is (3S,6S,9S,12R,14S)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-14-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R,14S)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-14-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 147053500 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | (3S,6S,9S,12R,14S)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-14-methyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | C[C@H]1C[C@@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H](Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C35H37N5O4/c1-22-16-31-34(43)38-28(17-23-10-4-2-5-11-23)32(41)37-29(19-25-20-36-27-15-9-8-14-26(25)27)33(42)39-30(35(44)40(31)21-22)18-24-12-6-3-7-13-24/h2-15,20,22,28-31,36H,16-19,21H2,1H3,(H,37,41)(H,38,43)(H,39,42)/t22-,28-,29-,30-,31+/m0/s1 |
| InChIKey | VVLYTRFBSFWZOK-XQRUKIMSSA-N |
| XLogP | 2.90 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |