C36H39N5O6 — CID 142499190
(3S,6R,9S,12R,14R)-3,9-dibenzyl-14-(1-hydroxyethoxy)-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 142499190) has the molecular formula C36H39N5O6 and a molecular weight of 637.74 g/mol. Its IUPAC name is (3S,6R,9S,12R,14R)-3,9-dibenzyl-14-(1-hydroxyethoxy)-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R,14R)-3,9-dibenzyl-14-(1-hydroxyethoxy)-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 142499190 |
| Molecular Formula | C36H39N5O6 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | (3S,6R,9S,12R,14R)-3,9-dibenzyl-14-(1-hydroxyethoxy)-6-(1H-indol-3-ylmethyl)-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC(O)O[C@@H]1C[C@@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H](Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C36H39N5O6/c1-22(42)47-26-19-32-35(45)39-29(16-23-10-4-2-5-11-23)33(43)38-30(18-25-20-37-28-15-9-8-14-27(25)28)34(44)40-31(36(46)41(32)21-26)17-24-12-6-3-7-13-24/h2-15,20,22,26,29-32,37,42H,16-19,21H2,1H3,(H,38,43)(H,39,45)(H,40,44)/t22?,26-,29+,30-,31+,32-/m1/s1 |
| InChIKey | XZMUXPMDJJKDRJ-REKNZVJUSA-N |
| XLogP | 1.99 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|