C36H39N7O5 — CID 153475179
2-amino-N-[(3S,6R,9S,12R,14R)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-14-yl]acetamide (PubChem CID 153475179) has the molecular formula C36H39N7O5 and a molecular weight of 649.75 g/mol. Its IUPAC name is 2-amino-N-[(3S,6R,9S,12R,14R)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-14-yl]acetamide.
| Compound Name | 2-amino-N-[(3S,6R,9S,12R,14R)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-14-yl]acetamide |
|---|---|
| PubChem CID | 153475179 |
| Molecular Formula | C36H39N7O5 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.30 |
| IUPAC Name | 2-amino-N-[(3S,6R,9S,12R,14R)-3,9-dibenzyl-6-(1H-indol-3-ylmethyl)-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-14-yl]acetamide |
| SMILES | NCC(=O)N[C@@H]1C[C@@H]2C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H](Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C36H39N7O5/c37-19-32(44)39-25-18-31-35(47)41-28(15-22-9-3-1-4-10-22)33(45)40-29(17-24-20-38-27-14-8-7-13-26(24)27)34(46)42-30(36(48)43(31)21-25)16-23-11-5-2-6-12-23/h1-14,20,25,28-31,38H,15-19,21,37H2,(H,39,44)(H,40,45)(H,41,47)(H,42,46)/t25-,28+,29-,30+,31-/m1/s1 |
| InChIKey | RBQRFUYTDGQEQF-MTFXRORISA-N |
| XLogP | 0.71 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |