C25H26N4O4 — CID 3854322
2-hydroxy-N-[3-(1H-indol-3-ylmethyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-phenylacetamide (PubChem CID 3854322) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-hydroxy-N-[3-(1H-indol-3-ylmethyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-phenylacetamide.
| Compound Name | 2-hydroxy-N-[3-(1H-indol-3-ylmethyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 3854322 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-hydroxy-N-[3-(1H-indol-3-ylmethyl)-1,4-dioxo-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazin-8-yl]-2-phenylacetamide |
| SMILES | O=C(NC1CCN2C(=O)C(Cc3c[nH]c4ccccc34)NC(=O)C2C1)C(O)c1ccccc1 |
| InChI | InChI=1S/C25H26N4O4/c30-22(15-6-2-1-3-7-15)24(32)27-17-10-11-29-21(13-17)23(31)28-20(25(29)33)12-16-14-26-19-9-5-4-8-18(16)19/h1-9,14,17,20-22,26,30H,10-13H2,(H,27,32)(H,28,31) |
| InChIKey | IPMCINSQYCRLIS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |