C22H23N3O2 — CID 163112973
3-benzyl-6-(1H-indol-3-ylmethyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 163112973) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-benzyl-6-(1H-indol-3-ylmethyl)-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | 3-benzyl-6-(1H-indol-3-ylmethyl)-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 163112973 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-benzyl-6-(1H-indol-3-ylmethyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)C(Cc2c[nH]c3ccccc23)N(C)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O2/c1-24-19(12-15-8-4-3-5-9-15)21(26)25(2)20(22(24)27)13-16-14-23-18-11-7-6-10-17(16)18/h3-11,14,19-20,23H,12-13H2,1-2H3 |
| InChIKey | REPYZBXULPHQIV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |