C22H17F6N3O2 — CID 10073370
3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)-1-methylimidazolidine-2,4-dione (PubChem CID 10073370) has the molecular formula C22H17F6N3O2 and a molecular weight of 469.39 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10073370 |
| Molecular Formula | C22H17F6N3O2 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)-1-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)C1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H17F6N3O2/c1-30-18(8-13-10-29-17-5-3-2-4-16(13)17)19(32)31(20(30)33)11-12-6-14(21(23,24)25)9-15(7-12)22(26,27)28/h2-7,9-10,18,29H,8,11H2,1H3 |
| InChIKey | ICBSQYXTXCHQCY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|