C26H25F6N3O2 — CID 85070946
[3,5-bis(trifluoromethyl)phenyl]-[6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone (PubChem CID 85070946) has the molecular formula C26H25F6N3O2 and a molecular weight of 525.49 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 85070946 |
| Molecular Formula | C26H25F6N3O2 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[6-(hydroxymethyl)-3-(1H-indol-3-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC2CCC(CO)N2CC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H25F6N3O2/c27-25(28,29)17-7-15(8-18(10-17)26(30,31)32)24(37)35-12-19-5-6-20(14-36)34(19)13-21(35)9-16-11-33-23-4-2-1-3-22(16)23/h1-4,7-8,10-11,19-21,33,36H,5-6,9,12-14H2 |
| InChIKey | AZOLEMPTFCMGAE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |