C25H21F6N3O2 — CID 87667647
[3,5-bis(trifluoromethyl)phenyl]-[(3R,7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone (PubChem CID 87667647) has the molecular formula C25H21F6N3O2 and a molecular weight of 509.45 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(3R,7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(3R,7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 87667647 |
| Molecular Formula | C25H21F6N3O2 |
| Molecular Weight | 509.45 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(3R,7R)-7-hydroxy-3-(1H-indol-3-ylmethyl)-3,4,6,7-tetrahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC2=C[C@@H](O)CN2C[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H21F6N3O2/c26-24(27,28)16-5-14(6-17(8-16)25(29,30)31)23(36)34-12-18-9-20(35)13-33(18)11-19(34)7-15-10-32-22-4-2-1-3-21(15)22/h1-6,8-10,19-20,32,35H,7,11-13H2/t19-,20-/m1/s1 |
| InChIKey | LCKZDJNQYOULMG-WOJBJXKFSA-N |
| XLogP | 4.83 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |