C24H20F6N4O — CID 86751332
2-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]acetonitrile (PubChem CID 86751332) has the molecular formula C24H20F6N4O and a molecular weight of 494.44 g/mol. Its IUPAC name is 2-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 86751332 |
| Molecular Formula | C24H20F6N4O |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C24H20F6N4O/c25-23(26,27)17-9-15(10-18(12-17)24(28,29)30)22(35)34-8-7-33(6-5-31)14-19(34)11-16-13-32-21-4-2-1-3-20(16)21/h1-4,9-10,12-13,19,32H,6-8,11,14H2/t19-/m1/s1 |
| InChIKey | CVOBLIYIJFPOCS-LJQANCHMSA-N |
| XLogP | 5.10 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|