C28H31F6N5O2 — CID 91014269
[(2R)-4-[3-(2-aminoethoxyamino)but-2-enyl]-2-(1H-indol-3-ylmethyl)piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone (PubChem CID 91014269) has the molecular formula C28H31F6N5O2 and a molecular weight of 583.58 g/mol. Its IUPAC name is [(2R)-4-[3-(2-aminoethoxyamino)but-2-enyl]-2-(1H-indol-3-ylmethyl)piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone.
| Compound Name | [(2R)-4-[3-(2-aminoethoxyamino)but-2-enyl]-2-(1H-indol-3-ylmethyl)piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 91014269 |
| Molecular Formula | C28H31F6N5O2 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | [(2R)-4-[3-(2-aminoethoxyamino)but-2-enyl]-2-(1H-indol-3-ylmethyl)piperazin-1-yl]-[3,5-bis(trifluoromethyl)phenyl]methanone |
| SMILES | CC(=CCN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2c[nH]c3ccccc23)C1)NOCCN |
| InChI | InChI=1S/C28H31F6N5O2/c1-18(37-41-11-7-35)6-8-38-9-10-39(23(17-38)14-20-16-36-25-5-3-2-4-24(20)25)26(40)19-12-21(27(29,30)31)15-22(13-19)28(32,33)34/h2-6,12-13,15-16,23,36-37H,7-11,14,17,35H2,1H3/t23-/m1/s1 |
| InChIKey | YVSFUSYDMZLEBM-HSZRJFAPSA-N |
| XLogP | 4.96 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|