C38H41F6N5O3 — CID 91097972
[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(3-morpholin-4-ylpropoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone (PubChem CID 91097972) has the molecular formula C38H41F6N5O3 and a molecular weight of 729.77 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(3-morpholin-4-ylpropoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(3-morpholin-4-ylpropoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91097972 |
| Molecular Formula | C38H41F6N5O3 |
| Molecular Weight | 729.77 g/mol |
| Exact Mass | 729.31 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(3-morpholin-4-ylpropoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(CC=C(NOCCCN2CCOCC2)c2ccccc2)C[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C38H41F6N5O3/c39-37(40,41)30-21-28(22-31(24-30)38(42,43)44)36(50)49-15-14-48(26-32(49)23-29-25-45-35-10-5-4-9-33(29)35)13-11-34(27-7-2-1-3-8-27)46-52-18-6-12-47-16-19-51-20-17-47/h1-5,7-11,21-22,24-25,32,45-46H,6,12-20,23,26H2/t32-/m1/s1 |
| InChIKey | GQGQAWUIWAJYGZ-JGCGQSQUSA-N |
| XLogP | 6.86 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|