C30H33F6N5O3 — CID 90825707
[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[2-(2-morpholin-4-ylethoxyamino)ethenyl]piperazin-1-yl]methanone (PubChem CID 90825707) has the molecular formula C30H33F6N5O3 and a molecular weight of 625.61 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[2-(2-morpholin-4-ylethoxyamino)ethenyl]piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[2-(2-morpholin-4-ylethoxyamino)ethenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90825707 |
| Molecular Formula | C30H33F6N5O3 |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[2-(2-morpholin-4-ylethoxyamino)ethenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(C=CNOCCN2CCOCC2)C[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H33F6N5O3/c31-29(32,33)23-15-21(16-24(18-23)30(34,35)36)28(42)41-8-7-40(6-5-38-44-14-11-39-9-12-43-13-10-39)20-25(41)17-22-19-37-27-4-2-1-3-26(22)27/h1-6,15-16,18-19,25,37-38H,7-14,17,20H2/t25-/m1/s1 |
| InChIKey | IOTXMYRGGQUIBJ-RUZDIDTESA-N |
| XLogP | 4.90 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|