C37H39F6N5O3 — CID 90801141
[3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(2-morpholin-4-ylethoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone (PubChem CID 90801141) has the molecular formula C37H39F6N5O3 and a molecular weight of 715.74 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(2-morpholin-4-ylethoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(2-morpholin-4-ylethoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90801141 |
| Molecular Formula | C37H39F6N5O3 |
| Molecular Weight | 715.74 g/mol |
| Exact Mass | 715.30 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[(2R)-2-(1H-indol-3-ylmethyl)-4-[3-(2-morpholin-4-ylethoxyamino)-3-phenylprop-2-enyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCN(CC=C(NOCCN2CCOCC2)c2ccccc2)C[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C37H39F6N5O3/c38-36(39,40)29-20-27(21-30(23-29)37(41,42)43)35(49)48-13-12-47(25-31(48)22-28-24-44-34-9-5-4-8-32(28)34)11-10-33(26-6-2-1-3-7-26)45-51-19-16-46-14-17-50-18-15-46/h1-10,20-21,23-24,31,44-45H,11-19,22,25H2/t31-/m1/s1 |
| InChIKey | MRQIBUDGJOYZFA-WJOKGBTCSA-N |
| XLogP | 6.47 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.74 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|