C25H23F6N3O2 — CID 87940298
3-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]propanal (PubChem CID 87940298) has the molecular formula C25H23F6N3O2 and a molecular weight of 511.47 g/mol. Its IUPAC name is 3-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]propanal.
| Compound Name | 3-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 87940298 |
| Molecular Formula | C25H23F6N3O2 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 3-[(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazin-1-yl]propanal |
| SMILES | O=CCCN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C25H23F6N3O2/c26-24(27,28)18-10-16(11-19(13-18)25(29,30)31)23(36)34-8-7-33(6-3-9-35)15-20(34)12-17-14-32-22-5-2-1-4-21(17)22/h1-2,4-5,9-11,13-14,20,32H,3,6-8,12,15H2/t20-/m1/s1 |
| InChIKey | UYTWONMLNOTZBF-HXUWFJFHSA-N |
| XLogP | 5.16 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|