C23H19F6N3O2 — CID 90744706
(3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carbaldehyde (PubChem CID 90744706) has the molecular formula C23H19F6N3O2 and a molecular weight of 483.41 g/mol. Its IUPAC name is (3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carbaldehyde.
| Compound Name | (3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 90744706 |
| Molecular Formula | C23H19F6N3O2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (3R)-4-[3,5-bis(trifluoromethyl)benzoyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C23H19F6N3O2/c24-22(25,26)16-7-14(8-17(10-16)23(27,28)29)21(34)32-6-5-31(13-33)12-18(32)9-15-11-30-20-4-2-1-3-19(15)20/h1-4,7-8,10-11,13,18,30H,5-6,9,12H2/t18-/m1/s1 |
| InChIKey | XPWJVRPSYIKVGW-GOSISDBHSA-N |
| XLogP | 4.73 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|