C30H25F6N5O — CID 11456035
[3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyrimidin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone (PubChem CID 11456035) has the molecular formula C30H25F6N5O and a molecular weight of 585.55 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyrimidin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyrimidin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 11456035 |
| Molecular Formula | C30H25F6N5O |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyrimidin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC2CCC(c3ncccn3)=CN2CC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H25F6N5O/c31-29(32,33)21-10-19(11-22(13-21)30(34,35)36)28(42)41-17-23-7-6-18(27-37-8-3-9-38-27)15-40(23)16-24(41)12-20-14-39-26-5-2-1-4-25(20)26/h1-5,8-11,13-15,23-24,39H,6-7,12,16-17H2 |
| InChIKey | KEYXXYVZBFDAPV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |