C31H26F6N4O — CID 11478790
[3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyridin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone (PubChem CID 11478790) has the molecular formula C31H26F6N4O and a molecular weight of 584.56 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyridin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyridin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 11478790 |
| Molecular Formula | C31H26F6N4O |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[3-(1H-indol-3-ylmethyl)-7-pyridin-2-yl-1,3,4,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl]methanone |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CC2CCC(c3ccccn3)=CN2CC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H26F6N4O/c32-30(33,34)22-11-20(12-23(14-22)31(35,36)37)29(42)41-18-24-9-8-19(27-6-3-4-10-38-27)16-40(24)17-25(41)13-21-15-39-28-7-2-1-5-26(21)28/h1-7,10-12,14-16,24-25,39H,8-9,13,17-18H2 |
| InChIKey | BWSOSGUOYKZJIG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |