C21H15F6N3O2 — CID 11744729
(5S)-3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 11744729) has the molecular formula C21H15F6N3O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is (5S)-3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11744729 |
| Molecular Formula | C21H15F6N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (5S)-3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(1H-indol-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F6N3O2/c22-20(23,24)13-5-11(6-14(8-13)21(25,26)27)10-30-18(31)17(29-19(30)32)7-12-9-28-16-4-2-1-3-15(12)16/h1-6,8-9,17,28H,7,10H2,(H,29,32)/t17-/m0/s1 |
| InChIKey | HJVOZXMMJRZKQU-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|