C20H18N4O3 — CID 24606105
4-[[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzamide (PubChem CID 24606105) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 24606105 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-[[4-(1H-indol-3-ylmethyl)-2,5-dioxoimidazolidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN2C(=O)NC(Cc3c[nH]c4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C20H18N4O3/c21-18(25)13-7-5-12(6-8-13)11-24-19(26)17(23-20(24)27)9-14-10-22-16-4-2-1-3-15(14)16/h1-8,10,17,22H,9,11H2,(H2,21,25)(H,23,27) |
| InChIKey | NARJHAOKNBVWHD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|